C16H26N4S — CID 107164131
4-[(1,4-dimethylpiperidin-4-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 107164131) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 4-[(1,4-dimethylpiperidin-4-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[(1,4-dimethylpiperidin-4-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107164131 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 4-[(1,4-dimethylpiperidin-4-yl)methylamino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(NCC2(C)CCN(C)CC2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C16H26N4S/c1-11-9-13(14(15(17)21)12(2)19-11)18-10-16(3)5-7-20(4)8-6-16/h9H,5-8,10H2,1-4H3,(H2,17,21)(H,18,19) |
| InChIKey | GYUSWTQOMHGFJM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|