About 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine
1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine (PubChem CID 107164166) has the molecular formula C16H33N3
and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine |
| PubChem CID | 107164166 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine |
| SMILES | CCNC1CCN(CC2(C)CCN(C)CC2)C(C)C1 |
| InChI | InChI=1S/C16H33N3/c1-5-17-15-6-9-19(14(2)12-15)13-16(3)7-10-18(4)11-8-16/h14-15,17H,5-13H2,1-4H3 |
| InChIKey | ZKYKNHRZOBYRLW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine?
The IUPAC name of 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine (CID 107164166) is 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine.
What is the SMILES notation for 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine?
The canonical SMILES for 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine is CCNC1CCN(CC2(C)CCN(C)CC2)C(C)C1.
What is the InChIKey of 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine?
The InChIKey is ZKYKNHRZOBYRLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3/c1-5-17-15-6-9-19(14(2)12-15)13-16(3)7-10-18(4)11-8-16/h14-15,17H,5-13H2,1-4H3.
What are the key properties of 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine?
1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine has a molecular weight of 267.46 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,4-dimethylpiperidin-4-yl)methyl]-N-ethyl-2-methylpiperidin-4-amine is sourced from PubChem (CID 107164166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).