C23H31N5O2 — CID 10716460
2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzonitrile (PubChem CID 10716460) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 10716460 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(CCCCN2CC(=O)N3CCCCC3C2=O)CC1 |
| InChI | InChI=1S/C23H31N5O2/c24-17-19-7-1-2-8-20(19)26-15-13-25(14-16-26)10-5-6-11-27-18-22(29)28-12-4-3-9-21(28)23(27)30/h1-2,7-8,21H,3-6,9-16,18H2 |
| InChIKey | QOCZOARDHLPYDZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|