About S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate
S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate (PubChem CID 10716473) has the molecular formula C21H35NO3SSi
and a molecular weight of 409.67 g/mol. Its IUPAC name is S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate |
| PubChem CID | 10716473 |
| Molecular Formula | C21H35NO3SSi |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate |
| SMILES | CC(=O)N[C@@H](C(=O)Sc1ccc(C)cc1)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H35NO3SSi/c1-14(2)19(25-27(8,9)21(5,6)7)18(22-16(4)23)20(24)26-17-12-10-15(3)11-13-17/h10-14,18-19H,1-9H3,(H,22,23)/t18-,19+/m1/s1 |
| InChIKey | YETPMYKLVXGHFW-MOPGFXCFSA-N |
| XLogP | 5.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate?
The IUPAC name of S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate (CID 10716473) is S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate.
What is the SMILES notation for S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate?
The canonical SMILES for S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate is CC(=O)N[C@@H](C(=O)Sc1ccc(C)cc1)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C.
What is the InChIKey of S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate?
The InChIKey is YETPMYKLVXGHFW-MOPGFXCFSA-N. The full InChI is InChI=1S/C21H35NO3SSi/c1-14(2)19(25-27(8,9)21(5,6)7)18(22-16(4)23)20(24)26-17-12-10-15(3)11-13-17/h10-14,18-19H,1-9H3,(H,22,23)/t18-,19+/m1/s1.
What are the key properties of S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate?
S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate has a molecular weight of 409.67 g/mol, XLogP of 5.16, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) (2R,3S)-2-acetamido-3-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanethioate is sourced from PubChem (CID 10716473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).