C19H22O8S — CID 10716489
1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-thiophen-2-ylpropan-1-one (PubChem CID 10716489) has the molecular formula C19H22O8S and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 10716489 |
| Molecular Formula | C19H22O8S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCc1cccs1)c1c(O)cccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22O8S/c20-9-14-16(23)17(24)18(25)19(27-14)26-13-5-1-4-11(21)15(13)12(22)7-6-10-3-2-8-28-10/h1-5,8,14,16-21,23-25H,6-7,9H2/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | LIWMMHIHEPPUNJ-IQZDNPOKSA-N |
| XLogP | 0.45 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |