About 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide
2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide (PubChem CID 10716502) has the molecular formula C23H30N4O3
and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide |
| PubChem CID | 10716502 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide |
| SMILES | COc1ccccc1N1CCN(CCC(=O)Nc2ccccc2C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-25(2)23(29)18-8-4-5-9-19(18)24-22(28)12-13-26-14-16-27(17-15-26)20-10-6-7-11-21(20)30-3/h4-11H,12-17H2,1-3H3,(H,24,28) |
| InChIKey | IUHSDXDFPGLZMT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide?
The IUPAC name of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide (CID 10716502) is 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide.
What is the SMILES notation for 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide?
The canonical SMILES for 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide is COc1ccccc1N1CCN(CCC(=O)Nc2ccccc2C(=O)N(C)C)CC1.
What is the InChIKey of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide?
The InChIKey is IUHSDXDFPGLZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4O3/c1-25(2)23(29)18-8-4-5-9-19(18)24-22(28)12-13-26-14-16-27(17-15-26)20-10-6-7-11-21(20)30-3/h4-11H,12-17H2,1-3H3,(H,24,28).
What are the key properties of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide?
2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide has a molecular weight of 410.52 g/mol, XLogP of 2.55, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propanoylamino]-N,N-dimethylbenzamide is sourced from PubChem (CID 10716502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).