About N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine (PubChem CID 107165595) has the molecular formula C15H28N6
and a molecular weight of 292.43 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine |
| PubChem CID | 107165595 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine |
| SMILES | CCc1nc(NN)c(C)c(NCC2(C)CCN(C)CC2)n1 |
| InChI | InChI=1S/C15H28N6/c1-5-12-18-13(11(2)14(19-12)20-16)17-10-15(3)6-8-21(4)9-7-15/h5-10,16H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | TVDSGLQQXSBDIG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine?
The IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine (CID 107165595) is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine.
What is the SMILES notation for N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine?
The canonical SMILES for N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine is CCc1nc(NN)c(C)c(NCC2(C)CCN(C)CC2)n1.
What is the InChIKey of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine?
The InChIKey is TVDSGLQQXSBDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N6/c1-5-12-18-13(11(2)14(19-12)20-16)17-10-15(3)6-8-21(4)9-7-15/h5-10,16H2,1-4H3,(H2,17,18,19,20).
What are the key properties of N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine?
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine has a molecular weight of 292.43 g/mol, XLogP of 1.78, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperidin-4-yl)methyl]-2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-amine is sourced from PubChem (CID 107165595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).