C14H26N6 — CID 107165617
N-[(1,4-dimethylpiperidin-4-yl)methyl]-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine (PubChem CID 107165617) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107165617 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(NN)c(C)c(NCC2(C)CCN(C)CC2)n1 |
| InChI | InChI=1S/C14H26N6/c1-10-12(17-11(2)18-13(10)19-15)16-9-14(3)5-7-20(4)8-6-14/h5-9,15H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | YMRJCQNZBZZALC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|