C23H24O5S — CID 10716616
(5S,8Z,12R,13Z)-12-hydroxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one (PubChem CID 10716616) has the molecular formula C23H24O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is (5S,8Z,12R,13Z)-12-hydroxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one.
| Compound Name | (5S,8Z,12R,13Z)-12-hydroxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one |
|---|---|
| PubChem CID | 10716616 |
| Molecular Formula | C23H24O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (5S,8Z,12R,13Z)-12-hydroxy-5-(methoxymethoxy)-12-methyl-13-phenylsulfanyl-1-oxacyclopentadeca-8,13-dien-6,10-diyn-2-one |
| SMILES | COCO[C@@H]1C#C/C=C\C#C[C@@](C)(O)/C(Sc2ccccc2)=C/COC(=O)CC1 |
| InChI | InChI=1S/C23H24O5S/c1-23(25)16-9-4-3-6-10-19(28-18-26-2)13-14-22(24)27-17-15-21(23)29-20-11-7-5-8-12-20/h3-5,7-8,11-12,15,19,25H,13-14,17-18H2,1-2H3/b4-3-,21-15-/t19-,23-/m1/s1 |
| InChIKey | NMZIHJDINWVJHW-BNBIXHBASA-N |
| XLogP | 3.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|