C12H17FN2S — CID 107166794
1-(5-fluoro-3-pyridinyl)-N-(thiolan-3-ylmethyl)ethanamine (PubChem CID 107166794) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(5-fluoro-3-pyridinyl)-N-(thiolan-3-ylmethyl)ethanamine.
| Compound Name | 1-(5-fluoro-3-pyridinyl)-N-(thiolan-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107166794 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-(5-fluoro-3-pyridinyl)-N-(thiolan-3-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCSC1)c1cncc(F)c1 |
| InChI | InChI=1S/C12H17FN2S/c1-9(11-4-12(13)7-14-6-11)15-5-10-2-3-16-8-10/h4,6-7,9-10,15H,2-3,5,8H2,1H3 |
| InChIKey | ZMKQNBNZZDXQPN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |