C9H12ClF2NOS — CID 107166911
N-[(4-chlorothiophen-2-yl)methyl]-2-(2,2-difluoroethoxy)ethanamine (PubChem CID 107166911) has the molecular formula C9H12ClF2NOS and a molecular weight of 255.72 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-2-(2,2-difluoroethoxy)ethanamine.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 107166911 |
| Molecular Formula | C9H12ClF2NOS |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
| SMILES | FC(F)COCCNCc1cc(Cl)cs1 |
| InChI | InChI=1S/C9H12ClF2NOS/c10-7-3-8(15-6-7)4-13-1-2-14-5-9(11)12/h3,6,9,13H,1-2,4-5H2 |
| InChIKey | GONYJWXJRGNEPV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|