C6H7F2N3O2 — CID 107168050
2,2-difluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide (PubChem CID 107168050) has the molecular formula C6H7F2N3O2 and a molecular weight of 191.14 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 107168050 |
| Molecular Formula | C6H7F2N3O2 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2,2-difluoro-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]acetamide |
| SMILES | O=C(NCCc1ncon1)C(F)F |
| InChI | InChI=1S/C6H7F2N3O2/c7-5(8)6(12)9-2-1-4-10-3-13-11-4/h3,5H,1-2H2,(H,9,12) |
| InChIKey | XSMLSPHHFDWWDY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |