C9H18F2N2O — CID 107168084
N-[2-[ethyl(propyl)amino]ethyl]-2,2-difluoroacetamide (PubChem CID 107168084) has the molecular formula C9H18F2N2O and a molecular weight of 208.25 g/mol. Its IUPAC name is N-[2-[ethyl(propyl)amino]ethyl]-2,2-difluoroacetamide.
| Compound Name | N-[2-[ethyl(propyl)amino]ethyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 107168084 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-[2-[ethyl(propyl)amino]ethyl]-2,2-difluoroacetamide |
| SMILES | CCCN(CC)CCNC(=O)C(F)F |
| InChI | InChI=1S/C9H18F2N2O/c1-3-6-13(4-2)7-5-12-9(14)8(10)11/h8H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | ZQLHUUHFPZPIKP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |