About N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide
N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide (PubChem CID 107168155) has the molecular formula C9H13F2NO
and a molecular weight of 189.20 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide |
| PubChem CID | 107168155 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide |
| SMILES | O=C(NCCC1=CCCC1)C(F)F |
| InChI | InChI=1S/C9H13F2NO/c10-8(11)9(13)12-6-5-7-3-1-2-4-7/h3,8H,1-2,4-6H2,(H,12,13) |
| InChIKey | IUKNHYQQNVBTEN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide?
The IUPAC name of N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide (CID 107168155) is N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide.
What is the SMILES notation for N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide?
The canonical SMILES for N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide is O=C(NCCC1=CCCC1)C(F)F.
What is the InChIKey of N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide?
The InChIKey is IUKNHYQQNVBTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO/c10-8(11)9(13)12-6-5-7-3-1-2-4-7/h3,8H,1-2,4-6H2,(H,12,13).
What are the key properties of N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide?
N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide has a molecular weight of 189.20 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(cyclopenten-1-yl)ethyl]-2,2-difluoroacetamide is sourced from PubChem (CID 107168155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).