C9H13F2NO2 — CID 107168174
N-(2-cyclopropyloxolan-3-yl)-2,2-difluoroacetamide (PubChem CID 107168174) has the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. Its IUPAC name is N-(2-cyclopropyloxolan-3-yl)-2,2-difluoroacetamide.
| Compound Name | N-(2-cyclopropyloxolan-3-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 107168174 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(2-cyclopropyloxolan-3-yl)-2,2-difluoroacetamide |
| SMILES | O=C(NC1CCOC1C1CC1)C(F)F |
| InChI | InChI=1S/C9H13F2NO2/c10-8(11)9(13)12-6-3-4-14-7(6)5-1-2-5/h5-8H,1-4H2,(H,12,13) |
| InChIKey | WLWKJQXZHOAMRL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |