About 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide
2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide (PubChem CID 107168198) has the molecular formula C6H6F2N2O2
and a molecular weight of 176.12 g/mol. Its IUPAC name is 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide |
| PubChem CID | 107168198 |
| Molecular Formula | C6H6F2N2O2 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide |
| SMILES | O=C(NCc1ccno1)C(F)F |
| InChI | InChI=1S/C6H6F2N2O2/c7-5(8)6(11)9-3-4-1-2-10-12-4/h1-2,5H,3H2,(H,9,11) |
| InChIKey | NCNWYSMZLXMBKP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide?
The IUPAC name of 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide (CID 107168198) is 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide.
What is the SMILES notation for 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide?
The canonical SMILES for 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide is O=C(NCc1ccno1)C(F)F.
What is the InChIKey of 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide?
The InChIKey is NCNWYSMZLXMBKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O2/c7-5(8)6(11)9-3-4-1-2-10-12-4/h1-2,5H,3H2,(H,9,11).
What are the key properties of 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide?
2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide has a molecular weight of 176.12 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N-(1,2-oxazol-5-ylmethyl)acetamide is sourced from PubChem (CID 107168198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).