C19H36O6Si2 — CID 10716830
(5S,7R,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 10716830) has the molecular formula C19H36O6Si2 and a molecular weight of 416.66 g/mol. Its IUPAC name is (5S,7R,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | (5S,7R,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 10716830 |
| Molecular Formula | C19H36O6Si2 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (5S,7R,8S,9S)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C2OC3O[C@@H]1C(=O)[C@H](O3)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O6Si2/c1-18(2,3)26(7,8)24-15-12-11(20)13-16(14(15)23-17(21-12)22-13)25-27(9,10)19(4,5)6/h12-17H,1-10H3/t12-,13+,14?,15-,16-,17?/m1/s1 |
| InChIKey | GRHPEMDOYOWYRP-WGGIPJPDSA-N |
| XLogP | 3.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|