About N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide
N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide (PubChem CID 107168303) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 107168303 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCCO)c1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c11-4-2-1-3-10-8(12)7-5-9-6-13-7/h5-6,11H,1-4H2,(H,10,12) |
| InChIKey | LOQNCWFPCXLXIU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide (CID 107168303) is N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide is O=C(NCCCCO)c1cncs1.
What is the InChIKey of N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide?
The InChIKey is LOQNCWFPCXLXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c11-4-2-1-3-10-8(12)7-5-9-6-13-7/h5-6,11H,1-4H2,(H,10,12).
What are the key properties of N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide?
N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide has a molecular weight of 200.26 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxybutyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 107168303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).