C27H31NO3 — CID 10716875
4-[(2,2,4,6,7-pentamethyl-5-phenylmethoxy-3H-1-benzofuran-3-yl)methoxy]aniline (PubChem CID 10716875) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-[(2,2,4,6,7-pentamethyl-5-phenylmethoxy-3H-1-benzofuran-3-yl)methoxy]aniline.
| Compound Name | 4-[(2,2,4,6,7-pentamethyl-5-phenylmethoxy-3H-1-benzofuran-3-yl)methoxy]aniline |
|---|---|
| PubChem CID | 10716875 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-[(2,2,4,6,7-pentamethyl-5-phenylmethoxy-3H-1-benzofuran-3-yl)methoxy]aniline |
| SMILES | Cc1c(C)c2c(c(C)c1OCc1ccccc1)C(COc1ccc(N)cc1)C(C)(C)O2 |
| InChI | InChI=1S/C27H31NO3/c1-17-18(2)26-24(19(3)25(17)30-15-20-9-7-6-8-10-20)23(27(4,5)31-26)16-29-22-13-11-21(28)12-14-22/h6-14,23H,15-16,28H2,1-5H3 |
| InChIKey | BLUITVXTYKUMSL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|