C20H38O7Si — CID 10716927
ethyl (E)-3-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate (PubChem CID 10716927) has the molecular formula C20H38O7Si and a molecular weight of 418.60 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10716927 |
| Molecular Formula | C20H38O7Si |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | ethyl (E)-3-[(2S,3R,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O7Si/c1-11-24-17(21)13-12-15-16(14-25-28(9,10)18(2,3)4)27-20(6,23-8)19(5,22-7)26-15/h12-13,15-16H,11,14H2,1-10H3/b13-12+/t15-,16+,19+,20+/m0/s1 |
| InChIKey | OYTJDSDXCUZCCF-RKHRAIECSA-N |
| XLogP | 3.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|