C22H31NO2Se — CID 10716999
(E)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-3-yl]but-2-en-1-one (PubChem CID 10716999) has the molecular formula C22H31NO2Se and a molecular weight of 420.46 g/mol. Its IUPAC name is (E)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-3-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-3-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 10716999 |
| Molecular Formula | C22H31NO2Se |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (E)-1-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-2-(phenylselanylmethyl)-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-3-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1[C@H](C[Se]c2ccccc2)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C22H31NO2Se/c1-5-9-20(24)23-21(15-26-17-10-7-6-8-11-17)25-19-14-16(2)12-13-18(19)22(23,3)4/h5-11,16,18-19,21H,12-15H2,1-4H3/b9-5+/t16-,18-,19-,21+/m1/s1 |
| InChIKey | VUZRBHUOPRAORX-UAAXDJHRSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|