C13H18F2N2O2S — CID 107173137
N-(azepan-4-yl)-2,6-difluoro-N-methylbenzenesulfonamide (PubChem CID 107173137) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is N-(azepan-4-yl)-2,6-difluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(azepan-4-yl)-2,6-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107173137 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(azepan-4-yl)-2,6-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCCNCC1)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H18F2N2O2S/c1-17(10-4-3-8-16-9-7-10)20(18,19)13-11(14)5-2-6-12(13)15/h2,5-6,10,16H,3-4,7-9H2,1H3 |
| InChIKey | QOFXOLGNPYOTMQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |