C24H29NO4S — CID 10717385
(Z)-7-[(1R,2S,3S,4S)-3-(naphthalen-2-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 10717385) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,3S,4S)-3-(naphthalen-2-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,3S,4S)-3-(naphthalen-2-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10717385 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (Z)-7-[(1R,2S,3S,4S)-3-(naphthalen-2-ylsulfonylamino)-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H29NO4S/c26-23(27)10-4-2-1-3-9-22-19-11-12-20(15-19)24(22)25-30(28,29)21-14-13-17-7-5-6-8-18(17)16-21/h1,3,5-8,13-14,16,19-20,22,24-25H,2,4,9-12,15H2,(H,26,27)/b3-1-/t19-,20+,22+,24+/m1/s1 |
| InChIKey | FIPYJDOEJWQULW-VGQIUGRMSA-N |
| XLogP | 4.73 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|