C16H20ClNO3 — CID 107175125
4-chloro-3-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid (PubChem CID 107175125) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 4-chloro-3-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid.
| Compound Name | 4-chloro-3-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107175125 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-chloro-3-[(2,2-dimethylcyclohexanecarbonyl)amino]benzoic acid |
| SMILES | CC1(C)CCCCC1C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C16H20ClNO3/c1-16(2)8-4-3-5-11(16)14(19)18-13-9-10(15(20)21)6-7-12(13)17/h6-7,9,11H,3-5,8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | RVGWLPYZFWGOPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |