C12H19NO3 — CID 107175695
2-[(2-methylcyclopentanecarbonyl)-prop-2-enylamino]acetic acid (PubChem CID 107175695) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[(2-methylcyclopentanecarbonyl)-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(2-methylcyclopentanecarbonyl)-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 107175695 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-[(2-methylcyclopentanecarbonyl)-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)C1CCCC1C |
| InChI | InChI=1S/C12H19NO3/c1-3-7-13(8-11(14)15)12(16)10-6-4-5-9(10)2/h3,9-10H,1,4-8H2,2H3,(H,14,15) |
| InChIKey | KRIDQCKHRJLHFY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|