C14H23NO3 — CID 107175978
3-methyl-1-(2-methylcyclopentanecarbonyl)piperidine-2-carboxylic acid (PubChem CID 107175978) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-methyl-1-(2-methylcyclopentanecarbonyl)piperidine-2-carboxylic acid.
| Compound Name | 3-methyl-1-(2-methylcyclopentanecarbonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107175978 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-methyl-1-(2-methylcyclopentanecarbonyl)piperidine-2-carboxylic acid |
| SMILES | CC1CCCC1C(=O)N1CCCC(C)C1C(=O)O |
| InChI | InChI=1S/C14H23NO3/c1-9-5-3-7-11(9)13(16)15-8-4-6-10(2)12(15)14(17)18/h9-12H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | FWQVEYMWTQSQEB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |