C10H15ClN2O — CID 107175983
2-(chloromethyl)-5-(2,2-dimethylcyclopentyl)-1,3,4-oxadiazole (PubChem CID 107175983) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2,2-dimethylcyclopentyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(2,2-dimethylcyclopentyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 107175983 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-(chloromethyl)-5-(2,2-dimethylcyclopentyl)-1,3,4-oxadiazole |
| SMILES | CC1(C)CCCC1c1nnc(CCl)o1 |
| InChI | InChI=1S/C10H15ClN2O/c1-10(2)5-3-4-7(10)9-13-12-8(6-11)14-9/h7H,3-6H2,1-2H3 |
| InChIKey | MYHZZBLFWPGVBE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|