C14H22O — CID 107176497
cyclohexen-1-yl-(2,2-dimethylcyclopentyl)methanone (PubChem CID 107176497) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,2-dimethylcyclopentyl)methanone.
| Compound Name | cyclohexen-1-yl-(2,2-dimethylcyclopentyl)methanone |
|---|---|
| PubChem CID | 107176497 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | cyclohexen-1-yl-(2,2-dimethylcyclopentyl)methanone |
| SMILES | CC1(C)CCCC1C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C14H22O/c1-14(2)10-6-9-12(14)13(15)11-7-4-3-5-8-11/h7,12H,3-6,8-10H2,1-2H3 |
| InChIKey | ICJBWWUPVAXMLQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |