C24H26N4O2S — CID 10717702
2-[5-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]isoindole-1,3-dione (PubChem CID 10717702) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[5-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10717702 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[5-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C24H26N4O2S/c29-23-18-8-2-3-9-19(18)24(30)28(23)13-7-1-6-12-26-14-16-27(17-15-26)22-20-10-4-5-11-21(20)31-25-22/h2-5,8-11H,1,6-7,12-17H2 |
| InChIKey | AGZPUSHGNOUMEV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|