C20H41NO7Si — CID 10717754
tert-butyl N-[(1R,2S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropyl]carbamate (PubChem CID 10717754) has the molecular formula C20H41NO7Si and a molecular weight of 435.63 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 10717754 |
| Molecular Formula | C20H41NO7Si |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | tert-butyl N-[(1R,2S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C20H41NO7Si/c1-18(2,3)28-17(24)21-15(13(23)11-22)16-14(26-20(7,8)27-16)12-25-29(9,10)19(4,5)6/h13-16,22-23H,11-12H2,1-10H3,(H,21,24)/t13-,14+,15-,16-/m1/s1 |
| InChIKey | OJZYTBNCDUCDCR-QKPAOTATSA-N |
| XLogP | 2.77 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|