C24H36O7 — CID 10717791
4-O-[(E,2R,3S,4R,5S)-1-[(2R,3R)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 10717791) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is 4-O-[(E,2R,3S,4R,5S)-1-[(2R,3R)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(E,2R,3S,4R,5S)-1-[(2R,3R)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 10717791 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-O-[(E,2R,3S,4R,5S)-1-[(2R,3R)-3-ethyl-6-oxo-2,3-dihydropyran-2-yl]-4-methoxy-3,5-dimethylnon-7-en-2-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@H]1OC(=O)C=C[C@H]1CC)OC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C24H36O7/c1-7-9-10-16(3)24(29-6)17(4)19(30-23(27)14-13-21(25)28-5)15-20-18(8-2)11-12-22(26)31-20/h7,9,11-14,16-20,24H,8,10,15H2,1-6H3/b9-7+,14-13+/t16-,17-,18+,19+,20+,24+/m0/s1 |
| InChIKey | BEJCELIGZGUOLS-JITDHAANSA-N |
| XLogP | 3.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|