C13H20BrNS — CID 107178270
1-(4-bromo-5-methylthiophen-2-yl)-N-methyl-1-(2-methylcyclopentyl)methanamine (PubChem CID 107178270) has the molecular formula C13H20BrNS and a molecular weight of 302.28 g/mol. Its IUPAC name is 1-(4-bromo-5-methylthiophen-2-yl)-N-methyl-1-(2-methylcyclopentyl)methanamine.
| Compound Name | 1-(4-bromo-5-methylthiophen-2-yl)-N-methyl-1-(2-methylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 107178270 |
| Molecular Formula | C13H20BrNS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-(4-bromo-5-methylthiophen-2-yl)-N-methyl-1-(2-methylcyclopentyl)methanamine |
| SMILES | CNC(c1cc(Br)c(C)s1)C1CCCC1C |
| InChI | InChI=1S/C13H20BrNS/c1-8-5-4-6-10(8)13(15-3)12-7-11(14)9(2)16-12/h7-8,10,13,15H,4-6H2,1-3H3 |
| InChIKey | ISBULTYBDQNCTJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |