C14H24N2O — CID 107178551
N-(cyanomethyl)-2,2-dimethyl-N-propylcyclohexane-1-carboxamide (PubChem CID 107178551) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-(cyanomethyl)-2,2-dimethyl-N-propylcyclohexane-1-carboxamide.
| Compound Name | N-(cyanomethyl)-2,2-dimethyl-N-propylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107178551 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-(cyanomethyl)-2,2-dimethyl-N-propylcyclohexane-1-carboxamide |
| SMILES | CCCN(CC#N)C(=O)C1CCCCC1(C)C |
| InChI | InChI=1S/C14H24N2O/c1-4-10-16(11-9-15)13(17)12-7-5-6-8-14(12,2)3/h12H,4-8,10-11H2,1-3H3 |
| InChIKey | DRHLRIIOJBVCRM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|