About 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine
6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine (PubChem CID 107178979) has the molecular formula C15H20BrN3
and a molecular weight of 322.25 g/mol. Its IUPAC name is 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine.
Molecular Properties
| Compound Name | 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine |
| PubChem CID | 107178979 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine |
| SMILES | CC1(C)CCCCC1c1nc2c(N)cc(Br)cc2[nH]1 |
| InChI | InChI=1S/C15H20BrN3/c1-15(2)6-4-3-5-10(15)14-18-12-8-9(16)7-11(17)13(12)19-14/h7-8,10H,3-6,17H2,1-2H3,(H,18,19) |
| InChIKey | AVSZIGDERHOKNU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine?
The IUPAC name of 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine (CID 107178979) is 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine.
What is the SMILES notation for 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine?
The canonical SMILES for 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine is CC1(C)CCCCC1c1nc2c(N)cc(Br)cc2[nH]1.
What is the InChIKey of 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine?
The InChIKey is AVSZIGDERHOKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3/c1-15(2)6-4-3-5-10(15)14-18-12-8-9(16)7-11(17)13(12)19-14/h7-8,10H,3-6,17H2,1-2H3,(H,18,19).
What are the key properties of 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine?
6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine has a molecular weight of 322.25 g/mol, XLogP of 4.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(2,2-dimethylcyclohexyl)-1H-benzimidazol-4-amine is sourced from PubChem (CID 107178979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).