C9H15N3 — CID 107180025
5-methyl-3-(2-methylcyclopentyl)-1H-1,2,4-triazole (PubChem CID 107180025) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-methyl-3-(2-methylcyclopentyl)-1H-1,2,4-triazole.
| Compound Name | 5-methyl-3-(2-methylcyclopentyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 107180025 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 5-methyl-3-(2-methylcyclopentyl)-1H-1,2,4-triazole |
| SMILES | Cc1nc(C2CCCC2C)n[nH]1 |
| InChI | InChI=1S/C9H15N3/c1-6-4-3-5-8(6)9-10-7(2)11-12-9/h6,8H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | BEGZZDDTXNKMPC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |