C24H50O3Si2 — CID 10718073
tert-butyl-[(E,3R,8S)-4,8-dimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)non-4-en-3-yl]oxy-dimethylsilane (PubChem CID 10718073) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is tert-butyl-[(E,3R,8S)-4,8-dimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)non-4-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3R,8S)-4,8-dimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)non-4-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10718073 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | tert-butyl-[(E,3R,8S)-4,8-dimethyl-6-methylidene-9-(2-trimethylsilylethoxymethoxy)non-4-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C(/C=C(\C)[C@@H](CC)O[Si](C)(C)C(C)(C)C)C[C@H](C)COCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H50O3Si2/c1-13-23(27-29(11,12)24(5,6)7)22(4)17-20(2)16-21(3)18-26-19-25-14-15-28(8,9)10/h17,21,23H,2,13-16,18-19H2,1,3-12H3/b22-17+/t21-,23+/m0/s1 |
| InChIKey | LRZBPDOUBCAENR-ODDPSODOSA-N |
| XLogP | 7.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|