C22H27N3O5S — CID 10718200
(2R,4S)-N-hydroxy-1-(4-phenoxyphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide (PubChem CID 10718200) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is (2R,4S)-N-hydroxy-1-(4-phenoxyphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-hydroxy-1-(4-phenoxyphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10718200 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (2R,4S)-N-hydroxy-1-(4-phenoxyphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1C[C@H](N2CCCCC2)CN1S(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c26-22(23-27)21-15-17(24-13-5-2-6-14-24)16-25(21)31(28,29)20-11-9-19(10-12-20)30-18-7-3-1-4-8-18/h1,3-4,7-12,17,21,27H,2,5-6,13-16H2,(H,23,26)/t17-,21+/m0/s1 |
| InChIKey | KJBQTISDZZFFDE-LAUBAEHRSA-N |
| XLogP | 2.60 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|