C21H32F6O3 — CID 10718239
(1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5R)-7,7,7-trifluoro-6-(methoxymethoxy)-5-methyl-6-(trifluoromethyl)hept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 10718239) has the molecular formula C21H32F6O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5R)-7,7,7-trifluoro-6-(methoxymethoxy)-5-methyl-6-(trifluoromethyl)hept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5R)-7,7,7-trifluoro-6-(methoxymethoxy)-5-methyl-6-(trifluoromethyl)hept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 10718239 |
| Molecular Formula | C21H32F6O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(E,2R,5R)-7,7,7-trifluoro-6-(methoxymethoxy)-5-methyl-6-(trifluoromethyl)hept-3-en-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | COCOC([C@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H32F6O3/c1-13(15-9-10-16-17(28)6-5-11-18(15,16)3)7-8-14(2)19(20(22,23)24,21(25,26)27)30-12-29-4/h7-8,13-17,28H,5-6,9-12H2,1-4H3/b8-7+/t13-,14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | LFZXKYISZWTYJG-KSKBIZIYSA-N |
| XLogP | 5.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|