C30H41NO2 — CID 10718293
4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl]morpholine (PubChem CID 10718293) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is 4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl]morpholine.
| Compound Name | 4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl]morpholine |
|---|---|
| PubChem CID | 10718293 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 4-[2-[(1E,3S)-3,7-dimethyl-1-phenylocta-1,6-dienyl]-3-ethoxy-5-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl]morpholine |
| SMILES | C=C(C)C1=CC(OCC)=C(/C(=C/[C@@H](C)CCC=C(C)C)c2ccccc2)C1N1CCOCC1 |
| InChI | InChI=1S/C30H41NO2/c1-7-33-28-21-26(23(4)5)30(31-16-18-32-19-17-31)29(28)27(25-14-9-8-10-15-25)20-24(6)13-11-12-22(2)3/h8-10,12,14-15,20-21,24,30H,4,7,11,13,16-19H2,1-3,5-6H3/b27-20+/t24-,30?/m0/s1 |
| InChIKey | BNILDUSBSGDTAO-ATIBHXIYSA-N |
| XLogP | 6.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|