C15H19NO3S — CID 107183108
(E)-3-[2-[[(2-methylcyclopentanecarbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 107183108) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (E)-3-[2-[[(2-methylcyclopentanecarbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[(2-methylcyclopentanecarbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107183108 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (E)-3-[2-[[(2-methylcyclopentanecarbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CC1CCCC1C(=O)NCc1sccc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H19NO3S/c1-10-3-2-4-12(10)15(19)16-9-13-11(7-8-20-13)5-6-14(17)18/h5-8,10,12H,2-4,9H2,1H3,(H,16,19)(H,17,18)/b6-5+ |
| InChIKey | VEXSVZOWGSSFNY-AATRIKPKSA-N |
| XLogP | 2.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|