C21H30Cl2O6 — CID 10718333
(1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol (PubChem CID 10718333) has the molecular formula C21H30Cl2O6 and a molecular weight of 449.37 g/mol. Its IUPAC name is (1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol.
| Compound Name | (1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 10718333 |
| Molecular Formula | C21H30Cl2O6 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-ol |
| SMILES | CC[C@](O)([C@H](OCc1c(Cl)cccc1Cl)[C@H]1COC(C)(C)O1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H30Cl2O6/c1-6-21(24,17-12-27-20(4,5)29-17)18(16-11-26-19(2,3)28-16)25-10-13-14(22)8-7-9-15(13)23/h7-9,16-18,24H,6,10-12H2,1-5H3/t16-,17-,18-,21-/m1/s1 |
| InChIKey | HLSRWDSXEQGMJI-NEYJZJCJSA-N |
| XLogP | 4.32 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |