C14H18BrCl — CID 107183607
1-bromo-3-[2-chloro-2-(2-methylcyclopentyl)ethyl]benzene (PubChem CID 107183607) has the molecular formula C14H18BrCl and a molecular weight of 301.65 g/mol. Its IUPAC name is 1-bromo-3-[2-chloro-2-(2-methylcyclopentyl)ethyl]benzene.
| Compound Name | 1-bromo-3-[2-chloro-2-(2-methylcyclopentyl)ethyl]benzene |
|---|---|
| PubChem CID | 107183607 |
| Molecular Formula | C14H18BrCl |
| Molecular Weight | 301.65 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-bromo-3-[2-chloro-2-(2-methylcyclopentyl)ethyl]benzene |
| SMILES | CC1CCCC1C(Cl)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H18BrCl/c1-10-4-2-7-13(10)14(16)9-11-5-3-6-12(15)8-11/h3,5-6,8,10,13-14H,2,4,7,9H2,1H3 |
| InChIKey | GLEKTPHYIINFKK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|