About ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate
ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate (PubChem CID 10718405) has the molecular formula C29H38O2S
and a molecular weight of 450.69 g/mol. Its IUPAC name is ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate |
| PubChem CID | 10718405 |
| Molecular Formula | C29H38O2S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate |
| SMILES | CCCCCCCCC1CCc2cc(/C(C)=C/c3ccc(C(=O)OCC)cc3)ccc2S1 |
| InChI | InChI=1S/C29H38O2S/c1-4-6-7-8-9-10-11-27-18-16-26-21-25(17-19-28(26)32-27)22(3)20-23-12-14-24(15-13-23)29(30)31-5-2/h12-15,17,19-21,27H,4-11,16,18H2,1-3H3/b22-20+ |
| InChIKey | AZQBNTMXFDQFCZ-LSDHQDQOSA-N |
| XLogP | 8.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate?
The IUPAC name of ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate (CID 10718405) is ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate.
What is the SMILES notation for ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate?
The canonical SMILES for ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate is CCCCCCCCC1CCc2cc(/C(C)=C/c3ccc(C(=O)OCC)cc3)ccc2S1.
What is the InChIKey of ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate?
The InChIKey is AZQBNTMXFDQFCZ-LSDHQDQOSA-N. The full InChI is InChI=1S/C29H38O2S/c1-4-6-7-8-9-10-11-27-18-16-26-21-25(17-19-28(26)32-27)22(3)20-23-12-14-24(15-13-23)29(30)31-5-2/h12-15,17,19-21,27H,4-11,16,18H2,1-3H3/b22-20+.
What are the key properties of ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate?
ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate has a molecular weight of 450.69 g/mol, XLogP of 8.58, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(E)-2-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)prop-1-enyl]benzoate is sourced from PubChem (CID 10718405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).