C12H21Cl2NO — CID 107184249
N-(1,3-dichloro-2-methylpropan-2-yl)-2,2-dimethylcyclopentane-1-carboxamide (PubChem CID 107184249) has the molecular formula C12H21Cl2NO and a molecular weight of 266.21 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-2,2-dimethylcyclopentane-1-carboxamide.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2,2-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 107184249 |
| Molecular Formula | C12H21Cl2NO |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-2,2-dimethylcyclopentane-1-carboxamide |
| SMILES | CC(CCl)(CCl)NC(=O)C1CCCC1(C)C |
| InChI | InChI=1S/C12H21Cl2NO/c1-11(2)6-4-5-9(11)10(16)15-12(3,7-13)8-14/h9H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | AEDVOQWXPRIZOO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|