C28H27N3O3 — CID 10718506
2-[(1S,2S,13R,21R)-22-but-3-enyl-2,16-dihydroxy-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]acetonitrile (PubChem CID 10718506) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[(1S,2S,13R,21R)-22-but-3-enyl-2,16-dihydroxy-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]acetonitrile.
| Compound Name | 2-[(1S,2S,13R,21R)-22-but-3-enyl-2,16-dihydroxy-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]acetonitrile |
|---|---|
| PubChem CID | 10718506 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-[(1S,2S,13R,21R)-22-but-3-enyl-2,16-dihydroxy-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]acetonitrile |
| SMILES | C=CCCN1CC[C@]23c4c5ccc(O)c4O[C@H]2c2[nH]c4ccc(CC#N)cc4c2C[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C28H27N3O3/c1-2-3-11-31-12-9-27-23-17-5-7-21(32)25(23)34-26(27)24-19(15-28(27,33)22(31)14-17)18-13-16(8-10-29)4-6-20(18)30-24/h2,4-7,13,22,26,30,32-33H,1,3,8-9,11-12,14-15H2/t22-,26+,27+,28-/m1/s1 |
| InChIKey | DVOVRRGUKBNSNI-CSZVXOJQSA-N |
| XLogP | 3.80 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|