C25H46O5Si — CID 10718554
(E,3R,4S)-4-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-8-(1,3-dioxolan-2-yl)-3-(2-hydroxyethyl)-4-methylnon-7-en-2-one (PubChem CID 10718554) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is (E,3R,4S)-4-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-8-(1,3-dioxolan-2-yl)-3-(2-hydroxyethyl)-4-methylnon-7-en-2-one.
| Compound Name | (E,3R,4S)-4-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-8-(1,3-dioxolan-2-yl)-3-(2-hydroxyethyl)-4-methylnon-7-en-2-one |
|---|---|
| PubChem CID | 10718554 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (E,3R,4S)-4-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-8-(1,3-dioxolan-2-yl)-3-(2-hydroxyethyl)-4-methylnon-7-en-2-one |
| SMILES | CC(=O)[C@H](CCO)[C@](C)(/C=C/CCO[Si](C)(C)C(C)(C)C)CC/C=C(\C)C1OCCO1 |
| InChI | InChI=1S/C25H46O5Si/c1-20(23-28-18-19-29-23)12-11-15-25(6,22(13-16-26)21(2)27)14-9-10-17-30-31(7,8)24(3,4)5/h9,12,14,22-23,26H,10-11,13,15-19H2,1-8H3/b14-9+,20-12+/t22-,25+/m0/s1 |
| InChIKey | XEASVORAUYCEGN-GEXNWAFHSA-N |
| XLogP | 5.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|