C15H13BrCl2N2O — CID 107185608
5-amino-N-(2-bromo-4,6-dimethylphenyl)-2,3-dichlorobenzamide (PubChem CID 107185608) has the molecular formula C15H13BrCl2N2O and a molecular weight of 388.09 g/mol. Its IUPAC name is 5-amino-N-(2-bromo-4,6-dimethylphenyl)-2,3-dichlorobenzamide.
| Compound Name | 5-amino-N-(2-bromo-4,6-dimethylphenyl)-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 107185608 |
| Molecular Formula | C15H13BrCl2N2O |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 5-amino-N-(2-bromo-4,6-dimethylphenyl)-2,3-dichlorobenzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cc(N)cc(Cl)c2Cl)c(Br)c1 |
| InChI | InChI=1S/C15H13BrCl2N2O/c1-7-3-8(2)14(11(16)4-7)20-15(21)10-5-9(19)6-12(17)13(10)18/h3-6H,19H2,1-2H3,(H,20,21) |
| InChIKey | AIBFSWBYJCMKLX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|