C13H17Cl2N3O2 — CID 107185636
5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-2,3-dichlorobenzamide (PubChem CID 107185636) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-2,3-dichlorobenzamide.
| Compound Name | 5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 107185636 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-amino-N-[2-(tert-butylamino)-2-oxoethyl]-2,3-dichlorobenzamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-13(2,3)18-10(19)6-17-12(20)8-4-7(16)5-9(14)11(8)15/h4-5H,6,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | SGCLPNYZVPZEDO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|