C11H10Cl2N2O5 — CID 107186282
3-[(2,3-dichloro-5-nitrobenzoyl)-methylamino]propanoic acid (PubChem CID 107186282) has the molecular formula C11H10Cl2N2O5 and a molecular weight of 321.12 g/mol. Its IUPAC name is 3-[(2,3-dichloro-5-nitrobenzoyl)-methylamino]propanoic acid.
| Compound Name | 3-[(2,3-dichloro-5-nitrobenzoyl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 107186282 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 3-[(2,3-dichloro-5-nitrobenzoyl)-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl2N2O5/c1-14(3-2-9(16)17)11(18)7-4-6(15(19)20)5-8(12)10(7)13/h4-5H,2-3H2,1H3,(H,16,17) |
| InChIKey | FGARSCBXAWVPJH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|