C28H18N4OS — CID 10718703
4-amino-6,12,13-triphenyl-3-oxa-8-thia-10,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile (PubChem CID 10718703) has the molecular formula C28H18N4OS and a molecular weight of 458.55 g/mol. Its IUPAC name is 4-amino-6,12,13-triphenyl-3-oxa-8-thia-10,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile.
| Compound Name | 4-amino-6,12,13-triphenyl-3-oxa-8-thia-10,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 10718703 |
| Molecular Formula | C28H18N4OS |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-amino-6,12,13-triphenyl-3-oxa-8-thia-10,11-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(sc3nnc(-c4ccccc4)c(-c4ccccc4)c23)C1c1ccccc1 |
| InChI | InChI=1S/C28H18N4OS/c29-16-20-21(17-10-4-1-5-11-17)26-25(33-27(20)30)23-22(18-12-6-2-7-13-18)24(31-32-28(23)34-26)19-14-8-3-9-15-19/h1-15,21H,30H2 |
| InChIKey | COUQJBCBEIOGNB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|